C12H14N3O9P — CID 134451503
[[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]phosphonic acid (PubChem CID 134451503) has the molecular formula C12H14N3O9P and a molecular weight of 375.23 g/mol. Its IUPAC name is [[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]phosphonic acid.
| Compound Name | [[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]phosphonic acid |
|---|---|
| PubChem CID | 134451503 |
| Molecular Formula | C12H14N3O9P |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | [[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]phosphonic acid |
| SMILES | O=C(CN(CCN1C(=O)C=CC1=O)P(=O)(O)O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H14N3O9P/c16-8-1-2-9(17)14(8)6-5-13(25(21,22)23)7-12(20)24-15-10(18)3-4-11(15)19/h1-2H,3-7H2,(H2,21,22,23) |
| InChIKey | KLMFQAYWXISUOZ-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 161.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|