About tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate
tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate (PubChem CID 134451541) has the molecular formula C13H19N3O5
and a molecular weight of 297.31 g/mol. Its IUPAC name is tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate |
| PubChem CID | 134451541 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CCN1C(=O)C=CC1=O)C(N)=O |
| InChI | InChI=1S/C13H19N3O5/c1-13(2,3)21-11(19)8-15(12(14)20)6-7-16-9(17)4-5-10(16)18/h4-5H,6-8H2,1-3H3,(H2,14,20) |
| InChIKey | COZKIDXKAIXIKR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate?
The IUPAC name of tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate (CID 134451541) is tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate.
What is the SMILES notation for tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate?
The canonical SMILES for tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate is CC(C)(C)OC(=O)CN(CCN1C(=O)C=CC1=O)C(N)=O.
What is the InChIKey of tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate?
The InChIKey is COZKIDXKAIXIKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O5/c1-13(2,3)21-11(19)8-15(12(14)20)6-7-16-9(17)4-5-10(16)18/h4-5H,6-8H2,1-3H3,(H2,14,20).
What are the key properties of tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate?
tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate has a molecular weight of 297.31 g/mol, XLogP of -0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[carbamoyl-[2-(2,5-dioxopyrrol-1-yl)ethyl]amino]acetate is sourced from PubChem (CID 134451541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).