C31H43F3O4S — CID 134451664
17-[2-(benzenesulfonyl)-5,5,5-trifluoro-4-hydroxy-4-methylpentyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 134451664) has the molecular formula C31H43F3O4S and a molecular weight of 568.74 g/mol. Its IUPAC name is 17-[2-(benzenesulfonyl)-5,5,5-trifluoro-4-hydroxy-4-methylpentyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[2-(benzenesulfonyl)-5,5,5-trifluoro-4-hydroxy-4-methylpentyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134451664 |
| Molecular Formula | C31H43F3O4S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 17-[2-(benzenesulfonyl)-5,5,5-trifluoro-4-hydroxy-4-methylpentyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C(CC(CC(C)(O)C(F)(F)F)S(=O)(=O)c3ccccc3)CCC12 |
| InChI | InChI=1S/C31H43F3O4S/c1-28-15-13-22(35)17-20(28)9-11-25-26-12-10-21(29(26,2)16-14-27(25)28)18-24(19-30(3,36)31(32,33)34)39(37,38)23-7-5-4-6-8-23/h4-9,21-22,24-27,35-36H,10-19H2,1-3H3 |
| InChIKey | GAZXTNXKUVTMLP-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|