C28H43F3O3 — CID 134451704
3-[(3R)-3-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol (PubChem CID 134451704) has the molecular formula C28H43F3O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 3-[(3R)-3-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol.
| Compound Name | 3-[(3R)-3-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol |
|---|---|
| PubChem CID | 134451704 |
| Molecular Formula | C28H43F3O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 3-[(3R)-3-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]butyl]oxolan-3-ol |
| SMILES | C[C@H](CCC1(O)CCOC1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@](O)(C(F)(F)F)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H43F3O3/c1-18(8-11-26(32)14-15-34-17-26)21-6-7-22-20-5-4-19-16-27(33,28(29,30)31)13-12-24(19,2)23(20)9-10-25(21,22)3/h4,18,20-23,32-33H,5-17H2,1-3H3/t18-,20+,21-,22+,23+,24+,25-,26?,27+/m1/s1 |
| InChIKey | BXTMQKBYPBVTGZ-DFUIMSDGSA-N |
| XLogP | 6.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|