C30H44F6O3S — CID 134451761
(5S)-5-[(1R,3aS,4R,5R,7aS)-4-ethyl-7a-methyl-5-(6,6,6-trifluorohexan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-(benzenesulfonyl)-1,1,1-trifluorohexan-2-ol (PubChem CID 134451761) has the molecular formula C30H44F6O3S and a molecular weight of 598.73 g/mol. Its IUPAC name is (5S)-5-[(1R,3aS,4R,5R,7aS)-4-ethyl-7a-methyl-5-(6,6,6-trifluorohexan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-(benzenesulfonyl)-1,1,1-trifluorohexan-2-ol.
| Compound Name | (5S)-5-[(1R,3aS,4R,5R,7aS)-4-ethyl-7a-methyl-5-(6,6,6-trifluorohexan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-(benzenesulfonyl)-1,1,1-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 134451761 |
| Molecular Formula | C30H44F6O3S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (5S)-5-[(1R,3aS,4R,5R,7aS)-4-ethyl-7a-methyl-5-(6,6,6-trifluorohexan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4-(benzenesulfonyl)-1,1,1-trifluorohexan-2-ol |
| SMILES | CC[C@@H]1[C@@H](C(C)CCCC(F)(F)F)CC[C@]2(C)[C@@H]([C@H](C)C(CC(O)C(F)(F)F)S(=O)(=O)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C30H44F6O3S/c1-5-22-23(19(2)10-9-16-29(31,32)33)15-17-28(4)24(13-14-25(22)28)20(3)26(18-27(37)30(34,35)36)40(38,39)21-11-7-6-8-12-21/h6-8,11-12,19-20,22-27,37H,5,9-10,13-18H2,1-4H3/t19?,20-,22+,23+,24+,25-,26?,27?,28+/m0/s1 |
| InChIKey | HPNDZPGTGUACMG-QXPLDSLOSA-N |
| XLogP | 8.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |