C30H43FO — CID 134451813
17-[(2R)-5-(4-fluorophenyl)pentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 134451813) has the molecular formula C30H43FO and a molecular weight of 438.67 g/mol. Its IUPAC name is 17-[(2R)-5-(4-fluorophenyl)pentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[(2R)-5-(4-fluorophenyl)pentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134451813 |
| Molecular Formula | C30H43FO |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 17-[(2R)-5-(4-fluorophenyl)pentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCCc1ccc(F)cc1)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C30H43FO/c1-20(5-4-6-21-7-10-23(31)11-8-21)26-13-14-27-25-12-9-22-19-24(32)15-17-29(22,2)28(25)16-18-30(26,27)3/h7-11,20,24-28,32H,4-6,12-19H2,1-3H3/t20-,24?,25?,26?,27?,28?,29?,30?/m1/s1 |
| InChIKey | FTJGKOFSEPKFMX-FUKKJUHSSA-N |
| XLogP | 7.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|