C28H39F3O4S — CID 134451822
(3S,8S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,11-diol (PubChem CID 134451822) has the molecular formula C28H39F3O4S and a molecular weight of 528.68 g/mol. Its IUPAC name is (3S,8S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (3S,8S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 134451822 |
| Molecular Formula | C28H39F3O4S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | (3S,8S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,11-diol |
| SMILES | CC12CC(O)C3[C@@H](CCC4C[C@](O)(C(F)(F)F)CCC43C)C1CCC2CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H39F3O4S/c1-25-13-14-27(33,28(29,30)31)16-19(25)8-10-21-22-11-9-18(26(22,2)17-23(32)24(21)25)12-15-36(34,35)20-6-4-3-5-7-20/h3-7,18-19,21-24,32-33H,8-17H2,1-2H3/t18?,19?,21-,22?,23?,24?,25?,26?,27-/m0/s1 |
| InChIKey | VSZDUNLOSXPQKW-WTSBYOOPSA-N |
| XLogP | 5.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |