C31H47NO2 — CID 134451836
(3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5S)-5-hydroxy-5-pyridin-2-ylpentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 134451836) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5S)-5-hydroxy-5-pyridin-2-ylpentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5S)-5-hydroxy-5-pyridin-2-ylpentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134451836 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3-ethyl-17-[(2R,5S)-5-hydroxy-5-pyridin-2-ylpentan-2-yl]-10,13-dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CC[C@H](O)c5ccccn5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H47NO2/c1-5-31(34)18-17-29(3)22(20-31)10-11-23-25-13-12-24(30(25,4)16-15-26(23)29)21(2)9-14-28(33)27-8-6-7-19-32-27/h6-8,10,19,21,23-26,28,33-34H,5,9,11-18,20H2,1-4H3/t21-,23+,24-,25+,26+,28+,29+,30-,31+/m1/s1 |
| InChIKey | WGCJPLNQULXSMS-OVHRTSSTSA-N |
| XLogP | 7.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|