C30H41F3O3S — CID 134452004
(17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluorohexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 134452004) has the molecular formula C30H41F3O3S and a molecular weight of 538.72 g/mol. Its IUPAC name is (17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluorohexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluorohexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134452004 |
| Molecular Formula | C30H41F3O3S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluorohexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC12CCC3C4CCC(O)CC4=CCC3C1CC[C@@H]2CCC(CCC(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H41F3O3S/c1-29-17-16-26-25-13-10-22(34)19-20(25)7-12-27(26)28(29)14-9-21(29)8-11-24(15-18-30(31,32)33)37(35,36)23-5-3-2-4-6-23/h2-7,21-22,24-28,34H,8-19H2,1H3/t21-,22?,24?,25?,26?,27?,28?,29?/m0/s1 |
| InChIKey | JLONACXOHQKRDX-ASYDQJQSSA-N |
| XLogP | 7.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|