C32H45F3O4S — CID 134452088
(3S)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 134452088) has the molecular formula C32H45F3O4S and a molecular weight of 582.77 g/mol. Its IUPAC name is (3S)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134452088 |
| Molecular Formula | C32H45F3O4S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | (3S)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-3-ethyl-13-methyl-2,4,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CCC2C(=CCC3C2CCC2(C)C(CCC(CC(O)C(F)(F)F)S(=O)(=O)c4ccccc4)CCC32)C1 |
| InChI | InChI=1S/C32H45F3O4S/c1-3-31(37)18-16-25-21(20-31)9-13-27-26(25)15-17-30(2)22(11-14-28(27)30)10-12-24(19-29(36)32(33,34)35)40(38,39)23-7-5-4-6-8-23/h4-9,22,24-29,36-37H,3,10-20H2,1-2H3/t22?,24?,25?,26?,27?,28?,29?,30?,31-/m0/s1 |
| InChIKey | ZZQZBHBMIPORIJ-ZZYDSILTSA-N |
| XLogP | 7.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|