C32H45F3O4S — CID 134452100
17-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 134452100) has the molecular formula C32H45F3O4S and a molecular weight of 582.77 g/mol. Its IUPAC name is 17-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 134452100 |
| Molecular Formula | C32H45F3O4S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 17-[(2S,5R)-3-(benzenesulfonyl)-5-hydroxyhexan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H](C1CCC2C3CC=C4CC(O)(C(F)(F)F)CCC4(C)C3CCC21C)C(C[C@@H](C)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H45F3O4S/c1-20(36)18-28(40(38,39)23-8-6-5-7-9-23)21(2)25-12-13-26-24-11-10-22-19-31(37,32(33,34)35)17-16-29(22,3)27(24)14-15-30(25,26)4/h5-10,20-21,24-28,36-37H,11-19H2,1-4H3/t20-,21+,24?,25?,26?,27?,28?,29?,30?,31?/m1/s1 |
| InChIKey | KKOGRRADYWWRCE-HWXUOANJSA-N |
| XLogP | 7.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|