C20H50O5Si5 — CID 13445288
2,4,6,8,10-pentamethyl-2,4,6,8,10-pentapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 13445288) has the molecular formula C20H50O5Si5 and a molecular weight of 511.05 g/mol. Its IUPAC name is 2,4,6,8,10-pentamethyl-2,4,6,8,10-pentapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentamethyl-2,4,6,8,10-pentapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 13445288 |
| Molecular Formula | C20H50O5Si5 |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 2,4,6,8,10-pentamethyl-2,4,6,8,10-pentapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CCC[Si]1(C)O[Si](C)(CCC)O[Si](C)(CCC)O[Si](C)(CCC)O[Si](C)(CCC)O1 |
| InChI | InChI=1S/C20H50O5Si5/c1-11-16-26(6)21-27(7,17-12-2)23-29(9,19-14-4)25-30(10,20-15-5)24-28(8,22-26)18-13-3/h11-20H2,1-10H3 |
| InChIKey | PJMIGFTVONALLU-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|