C30H70O5Si5 — CID 13445289
2,2,4,4,6,6,8,8,10,10-decapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 13445289) has the molecular formula C30H70O5Si5 and a molecular weight of 651.32 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10-decapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,2,4,4,6,6,8,8,10,10-decapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 13445289 |
| Molecular Formula | C30H70O5Si5 |
| Molecular Weight | 651.32 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decapropyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CCC[Si]1(CCC)O[Si](CCC)(CCC)O[Si](CCC)(CCC)O[Si](CCC)(CCC)O[Si](CCC)(CCC)O1 |
| InChI | InChI=1S/C30H70O5Si5/c1-11-21-36(22-12-2)31-37(23-13-3,24-14-4)33-39(27-17-7,28-18-8)35-40(29-19-9,30-20-10)34-38(32-36,25-15-5)26-16-6/h11-30H2,1-10H3 |
| InChIKey | GDOAFPKXPORDJU-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.32 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|