About 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile
4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile (PubChem CID 134453215) has the molecular formula C16H10Cl2N4O
and a molecular weight of 345.19 g/mol. Its IUPAC name is 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile |
| PubChem CID | 134453215 |
| Molecular Formula | C16H10Cl2N4O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile |
| SMILES | Cc1cc(=O)c2c(N)cncc2n1-c1c(Cl)cc(C#N)cc1Cl |
| InChI | InChI=1S/C16H10Cl2N4O/c1-8-2-14(23)15-12(20)6-21-7-13(15)22(8)16-10(17)3-9(5-19)4-11(16)18/h2-4,6-7H,20H2,1H3 |
| InChIKey | MBDKQRVNWRBRJK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile?
The IUPAC name of 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile (CID 134453215) is 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile.
What is the SMILES notation for 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile?
The canonical SMILES for 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile is Cc1cc(=O)c2c(N)cncc2n1-c1c(Cl)cc(C#N)cc1Cl.
What is the InChIKey of 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile?
The InChIKey is MBDKQRVNWRBRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2N4O/c1-8-2-14(23)15-12(20)6-21-7-13(15)22(8)16-10(17)3-9(5-19)4-11(16)18/h2-4,6-7H,20H2,1H3.
What are the key properties of 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile?
4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile has a molecular weight of 345.19 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-2-methyl-4-oxo-1,7-naphthyridin-1-yl)-3,5-dichlorobenzonitrile is sourced from PubChem (CID 134453215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).