C27H50O13S — CID 134453290
3-methylbutyl 6-methoxy-2-[3-[[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methylsulfanyl]propyl]hexanoate (PubChem CID 134453290) has the molecular formula C27H50O13S and a molecular weight of 614.75 g/mol. Its IUPAC name is 3-methylbutyl 6-methoxy-2-[3-[[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methylsulfanyl]propyl]hexanoate.
| Compound Name | 3-methylbutyl 6-methoxy-2-[3-[[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methylsulfanyl]propyl]hexanoate |
|---|---|
| PubChem CID | 134453290 |
| Molecular Formula | C27H50O13S |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | 3-methylbutyl 6-methoxy-2-[3-[[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methylsulfanyl]propyl]hexanoate |
| SMILES | COCCCCC(CCCSC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)C(=O)OCCC(C)C |
| InChI | InChI=1S/C27H50O13S/c1-15(2)9-11-37-25(35)16(7-4-5-10-36-3)8-6-12-41-14-18-20(30)22(32)24(34)27(39-18)40-26-23(33)21(31)19(29)17(13-28)38-26/h15-24,26-34H,4-14H2,1-3H3/t16?,17-,18-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1 |
| InChIKey | HHNHPSVFDNEVMJ-ZIYCOPPDSA-N |
| XLogP | -0.85 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|