C26H33F3N6O — CID 134453459
6-[(6S,8R)-7-(2,2-difluoro-3-methoxypropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine (PubChem CID 134453459) has the molecular formula C26H33F3N6O and a molecular weight of 502.59 g/mol. Its IUPAC name is 6-[(6S,8R)-7-(2,2-difluoro-3-methoxypropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(6S,8R)-7-(2,2-difluoro-3-methoxypropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 134453459 |
| Molecular Formula | C26H33F3N6O |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 6-[(6S,8R)-7-(2,2-difluoro-3-methoxypropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
| SMILES | COCC(F)(F)CN1[C@H](c2ccc(NC3CN(CCCF)C3)cn2)c2ccc3[nH]ncc3c2C[C@H]1C |
| InChI | InChI=1S/C26H33F3N6O/c1-17-10-21-20(5-7-23-22(21)12-31-33-23)25(35(17)15-26(28,29)16-36-2)24-6-4-18(11-30-24)32-19-13-34(14-19)9-3-8-27/h4-7,11-12,17,19,25,32H,3,8-10,13-16H2,1-2H3,(H,31,33)/t17-,25+/m1/s1 |
| InChIKey | BFXKWHZHXIVGOE-NSYGIPOTSA-N |
| XLogP | 4.03 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |