C28H34F2N4O2 — CID 134453463
(6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline (PubChem CID 134453463) has the molecular formula C28H34F2N4O2 and a molecular weight of 496.60 g/mol. Its IUPAC name is (6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline.
| Compound Name | (6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
|---|---|
| PubChem CID | 134453463 |
| Molecular Formula | C28H34F2N4O2 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (6S,8R)-7-[(1-fluorocyclopropyl)methyl]-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
| SMILES | COc1cc(OC2CN(CCCF)C2)ccc1[C@@H]1c2ccc3[nH]ncc3c2C[C@@H](C)N1CC1(F)CC1 |
| InChI | InChI=1S/C28H34F2N4O2/c1-18-12-23-21(6-7-25-24(23)14-31-32-25)27(34(18)17-28(30)8-9-28)22-5-4-19(13-26(22)35-2)36-20-15-33(16-20)11-3-10-29/h4-7,13-14,18,20,27H,3,8-12,15-17H2,1-2H3,(H,31,32)/t18-,27+/m1/s1 |
| InChIKey | MRUYVXJFVOSZEV-CLYVBNDRSA-N |
| XLogP | 4.83 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |