C27H34F3N5O — CID 134453506
N-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 134453506) has the molecular formula C27H34F3N5O and a molecular weight of 501.60 g/mol. Its IUPAC name is N-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 134453506 |
| Molecular Formula | C27H34F3N5O |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | N-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | COc1cc(NC2CN(CCCF)C2)ccc1[C@@H]1c2ccc3[nH]ncc3c2C[C@@H](C)N1CC(C)(F)F |
| InChI | InChI=1S/C27H34F3N5O/c1-17-11-22-20(7-8-24-23(22)13-31-33-24)26(35(17)16-27(2,29)30)21-6-5-18(12-25(21)36-3)32-19-14-34(15-19)10-4-9-28/h5-8,12-13,17,19,26,32H,4,9-11,14-16H2,1-3H3,(H,31,33)/t17-,26+/m1/s1 |
| InChIKey | PPMFNADUOOVZPG-QUGAMOGWSA-N |
| XLogP | 5.02 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |