C34H45F2N5O4 — CID 134453511
tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate (PubChem CID 134453511) has the molecular formula C34H45F2N5O4 and a molecular weight of 625.76 g/mol. Its IUPAC name is tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134453511 |
| Molecular Formula | C34H45F2N5O4 |
| Molecular Weight | 625.76 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoropropyl)-8-methyl-3-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate |
| SMILES | COc1cc(NC2CN(C(=O)OC(C)(C)C)C2)ccc1[C@@H]1c2ccc3c(cnn3C3CCCCO3)c2C[C@@H](C)N1CC(C)(F)F |
| InChI | InChI=1S/C34H45F2N5O4/c1-21-15-26-24(12-13-28-27(26)17-37-41(28)30-9-7-8-14-44-30)31(40(21)20-34(5,35)36)25-11-10-22(16-29(25)43-6)38-23-18-39(19-23)32(42)45-33(2,3)4/h10-13,16-17,21,23,30-31,38H,7-9,14-15,18-20H2,1-6H3/t21-,30?,31+/m1/s1 |
| InChIKey | SHPYZDUUIBJZEK-VZFTWRBLSA-N |
| XLogP | 6.77 |
| TPSA | 81.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |