C26H32F3N5O — CID 134453518
N-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 134453518) has the molecular formula C26H32F3N5O and a molecular weight of 487.57 g/mol. Its IUPAC name is N-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 134453518 |
| Molecular Formula | C26H32F3N5O |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | COc1cc(NC2CN(CCCF)C2)ccc1[C@@H]1c2ccc3[nH]ncc3c2C[C@@H](C)N1CC(F)F |
| InChI | InChI=1S/C26H32F3N5O/c1-16-10-21-19(6-7-23-22(21)12-30-32-23)26(34(16)15-25(28)29)20-5-4-17(11-24(20)35-2)31-18-13-33(14-18)9-3-8-27/h4-7,11-12,16,18,25-26,31H,3,8-10,13-15H2,1-2H3,(H,30,32)/t16-,26+/m1/s1 |
| InChIKey | IVBCTFVBWGUGKC-DXPJPUQTSA-N |
| XLogP | 4.63 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |