C33H43F2N5O4 — CID 134453521
tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-2-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate (PubChem CID 134453521) has the molecular formula C33H43F2N5O4 and a molecular weight of 611.73 g/mol. Its IUPAC name is tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-2-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-2-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134453521 |
| Molecular Formula | C33H43F2N5O4 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | tert-butyl 3-[4-[(6S,8R)-7-(2,2-difluoroethyl)-8-methyl-2-(oxan-2-yl)-8,9-dihydro-6H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-methoxyanilino]azetidine-1-carboxylate |
| SMILES | COc1cc(NC2CN(C(=O)OC(C)(C)C)C2)ccc1[C@@H]1c2ccc3nn(C4CCCCO4)cc3c2C[C@@H](C)N1CC(F)F |
| InChI | InChI=1S/C33H43F2N5O4/c1-20-14-25-23(11-12-27-26(25)18-40(37-27)30-8-6-7-13-43-30)31(39(20)19-29(34)35)24-10-9-21(15-28(24)42-5)36-22-16-38(17-22)32(41)44-33(2,3)4/h9-12,15,18,20,22,29-31,36H,6-8,13-14,16-17,19H2,1-5H3/t20-,30?,31+/m1/s1 |
| InChIKey | XOLYAXHNNHGAFF-VOCBJCOPSA-N |
| XLogP | 6.38 |
| TPSA | 81.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |