C26H31F4N5O — CID 134453528
1-(3-fluoropropyl)-N-[3-methoxy-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine (PubChem CID 134453528) has the molecular formula C26H31F4N5O and a molecular weight of 505.56 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-N-[3-methoxy-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine.
| Compound Name | 1-(3-fluoropropyl)-N-[3-methoxy-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine |
|---|---|
| PubChem CID | 134453528 |
| Molecular Formula | C26H31F4N5O |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 1-(3-fluoropropyl)-N-[3-methoxy-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]azetidin-3-amine |
| SMILES | COc1cc(NC2CN(CCCF)C2)ccc1[C@@H]1c2ccc3[nH]ncc3c2C[C@@H](C)N1CC(F)(F)F |
| InChI | InChI=1S/C26H31F4N5O/c1-16-10-21-19(6-7-23-22(21)12-31-33-23)25(35(16)15-26(28,29)30)20-5-4-17(11-24(20)36-2)32-18-13-34(14-18)9-3-8-27/h4-7,11-12,16,18,25,32H,3,8-10,13-15H2,1-2H3,(H,31,33)/t16-,25+/m1/s1 |
| InChIKey | JUMJODAYGHYIAH-CPJLOUKISA-N |
| XLogP | 4.93 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |