C24H27F5N6 — CID 134453532
2-fluoro-N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine (PubChem CID 134453532) has the molecular formula C24H27F5N6 and a molecular weight of 494.51 g/mol. Its IUPAC name is 2-fluoro-N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine.
| Compound Name | 2-fluoro-N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 134453532 |
| Molecular Formula | C24H27F5N6 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-fluoro-N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(NC3CN(CCCF)C3)c(F)n2)N1CC(F)(F)F |
| InChI | InChI=1S/C24H27F5N6/c1-14-9-17-16(3-4-19-18(17)10-30-33-19)22(35(14)13-24(27,28)29)20-5-6-21(23(26)32-20)31-15-11-34(12-15)8-2-7-25/h3-6,10,14-15,22,31H,2,7-9,11-13H2,1H3,(H,30,33)/t14-,22+/m1/s1 |
| InChIKey | CRBIBFLRQNHOTI-PEBXRYMYSA-N |
| XLogP | 4.45 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|