C26H34F2N6 — CID 134453564
6-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine (PubChem CID 134453564) has the molecular formula C26H34F2N6 and a molecular weight of 468.60 g/mol. Its IUPAC name is 6-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 134453564 |
| Molecular Formula | C26H34F2N6 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 6-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(C)(C)F |
| InChI | InChI=1S/C26H34F2N6/c1-17-11-21-20(6-8-23-22(21)13-30-32-23)25(34(17)16-26(2,3)28)24-7-5-18(12-29-24)31-19-14-33(15-19)10-4-9-27/h5-8,12-13,17,19,25,31H,4,9-11,14-16H2,1-3H3,(H,30,32)/t17-,25+/m1/s1 |
| InChIKey | RMHSPVDIAHEXNT-NSYGIPOTSA-N |
| XLogP | 4.50 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |