C28H37F2N5O — CID 134453565
N-[4-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 134453565) has the molecular formula C28H37F2N5O and a molecular weight of 497.63 g/mol. Its IUPAC name is N-[4-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 134453565 |
| Molecular Formula | C28H37F2N5O |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | N-[4-[(6S,8R)-7-(2-fluoro-2-methylpropyl)-8-methyl-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-methoxyphenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | COc1cc(NC2CN(CCCF)C2)ccc1[C@@H]1c2ccc3[nH]ncc3c2C[C@@H](C)N1CC(C)(C)F |
| InChI | InChI=1S/C28H37F2N5O/c1-18-12-23-21(8-9-25-24(23)14-31-33-25)27(35(18)17-28(2,3)30)22-7-6-19(13-26(22)36-4)32-20-15-34(16-20)11-5-10-29/h6-9,13-14,18,20,27,32H,5,10-12,15-17H2,1-4H3,(H,31,33)/t18-,27+/m1/s1 |
| InChIKey | LXPLSZAVQYCVGQ-CLYVBNDRSA-N |
| XLogP | 5.11 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |