C19H15BrFN7O3 — CID 134454354
N'-[2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl]benzenecarboximidamide (PubChem CID 134454354) has the molecular formula C19H15BrFN7O3 and a molecular weight of 488.28 g/mol. Its IUPAC name is N'-[2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl]benzenecarboximidamide.
| Compound Name | N'-[2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 134454354 |
| Molecular Formula | C19H15BrFN7O3 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | N'-[2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl]benzenecarboximidamide |
| SMILES | N/C(=N\CCNc1nonc1-c1noc(=O)n1-c1ccc(F)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C19H15BrFN7O3/c20-13-10-12(6-7-14(13)21)28-18(27-30-19(28)29)15-17(26-31-25-15)24-9-8-23-16(22)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H2,22,23)(H,24,26) |
| InChIKey | OQTUWTJRCJKAPO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|