C15H14BrFN6O3S2 — CID 134454450
2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl N,N-dimethylcarbamodithioate (PubChem CID 134454450) has the molecular formula C15H14BrFN6O3S2 and a molecular weight of 489.35 g/mol. Its IUPAC name is 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl N,N-dimethylcarbamodithioate.
| Compound Name | 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 134454450 |
| Molecular Formula | C15H14BrFN6O3S2 |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 2-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]ethyl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SCCNc1nonc1-c1noc(=O)n1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H14BrFN6O3S2/c1-22(2)15(27)28-6-5-18-12-11(19-26-20-12)13-21-25-14(24)23(13)8-3-4-10(17)9(16)7-8/h3-4,7H,5-6H2,1-2H3,(H,18,20) |
| InChIKey | YJWHUBPXCMYTTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|