C21H26N2O2 — CID 134454564
4-[1-[(3aR,6aS)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol (PubChem CID 134454564) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-[1-[(3aR,6aS)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol.
| Compound Name | 4-[1-[(3aR,6aS)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 134454564 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-[1-[(3aR,6aS)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]phenol |
| SMILES | CC(CN1C[C@H]2CC(Oc3cccnc3)C[C@H]2C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-15(16-4-6-19(24)7-5-16)12-23-13-17-9-21(10-18(17)14-23)25-20-3-2-8-22-11-20/h2-8,11,15,17-18,21,24H,9-10,12-14H2,1H3/t15?,17-,18+,21? |
| InChIKey | CALMHGFOUOCWBW-ZHFRAHACSA-N |
| XLogP | 3.68 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |