C21H25ClN2O2 — CID 134454565
6-[1-[(3aS,6aR)-5-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]pyridin-3-ol (PubChem CID 134454565) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 6-[1-[(3aS,6aR)-5-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]pyridin-3-ol.
| Compound Name | 6-[1-[(3aS,6aR)-5-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 134454565 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 6-[1-[(3aS,6aR)-5-(2-chlorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]propan-2-yl]pyridin-3-ol |
| SMILES | CC(CN1C[C@H]2CC(Oc3ccccc3Cl)C[C@H]2C1)c1ccc(O)cn1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-14(20-7-6-17(25)10-23-20)11-24-12-15-8-18(9-16(15)13-24)26-21-5-3-2-4-19(21)22/h2-7,10,14-16,18,25H,8-9,11-13H2,1H3/t14?,15-,16+,18? |
| InChIKey | BRRZCAQKGXDUHO-BHBVFMNGSA-N |
| XLogP | 4.33 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |