C15H22S — CID 134454735
[(3S,4R)-3,4-diethylcyclopentyl]sulfanylbenzene (PubChem CID 134454735) has the molecular formula C15H22S and a molecular weight of 234.41 g/mol. Its IUPAC name is [(3S,4R)-3,4-diethylcyclopentyl]sulfanylbenzene.
| Compound Name | [(3S,4R)-3,4-diethylcyclopentyl]sulfanylbenzene |
|---|---|
| PubChem CID | 134454735 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [(3S,4R)-3,4-diethylcyclopentyl]sulfanylbenzene |
| SMILES | CC[C@@H]1CC(Sc2ccccc2)C[C@@H]1CC |
| InChI | InChI=1S/C15H22S/c1-3-12-10-15(11-13(12)4-2)16-14-8-6-5-7-9-14/h5-9,12-13,15H,3-4,10-11H2,1-2H3/t12-,13+,15? |
| InChIKey | KRFRQKRPCQSHJH-NNQSOWQGSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |