C16H20N3O2S- — CID 134454788
(2E,3Z,5S)-5-[(1-methylimidazol-2-yl)methyl]-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate (PubChem CID 134454788) has the molecular formula C16H20N3O2S- and a molecular weight of 318.42 g/mol. Its IUPAC name is (2E,3Z,5S)-5-[(1-methylimidazol-2-yl)methyl]-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate.
| Compound Name | (2E,3Z,5S)-5-[(1-methylimidazol-2-yl)methyl]-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate |
|---|---|
| PubChem CID | 134454788 |
| Molecular Formula | C16H20N3O2S- |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2E,3Z,5S)-5-[(1-methylimidazol-2-yl)methyl]-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](Cc2nccn2C)CN(S(=O)[O-])/C1=C/C=C |
| InChI | InChI=1S/C16H21N3O2S/c1-4-6-14-10-13(11-16-17-8-9-18(16)3)12-19(22(20)21)15(14)7-5-2/h4-9,13H,1-2,10-12H2,3H3,(H,20,21)/p-1/b14-6-,15-7+/t13-/m0/s1 |
| InChIKey | QNDUIWWJBQVGRO-MDLBAVIPSA-M |
| XLogP | 2.26 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|