C16H18N6O2 — CID 134454942
7,15-ditert-butyl-4,12-dioxa-3,5,8,11,13,16-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2,5,7,10,13,15-heptaene (PubChem CID 134454942) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 7,15-ditert-butyl-4,12-dioxa-3,5,8,11,13,16-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2,5,7,10,13,15-heptaene.
| Compound Name | 7,15-ditert-butyl-4,12-dioxa-3,5,8,11,13,16-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2,5,7,10,13,15-heptaene |
|---|---|
| PubChem CID | 134454942 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 7,15-ditert-butyl-4,12-dioxa-3,5,8,11,13,16-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2,5,7,10,13,15-heptaene |
| SMILES | CC(C)(C)c1nc2c3nonc3c(C(C)(C)C)nc2c2nonc12 |
| InChI | InChI=1S/C16H18N6O2/c1-15(2,3)13-11-9(19-23-21-11)8-7(17-13)10-12(22-24-20-10)14(18-8)16(4,5)6/h1-6H3 |
| InChIKey | WWLJUJZDYJKUFK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |