C21H22ClN7O2 — CID 134455444
5-chloro-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine (PubChem CID 134455444) has the molecular formula C21H22ClN7O2 and a molecular weight of 439.91 g/mol. Its IUPAC name is 5-chloro-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134455444 |
| Molecular Formula | C21H22ClN7O2 |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 5-chloro-N-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
| SMILES | COc1c(Nc2cc(Cl)nc3c2ncn3C2CCCCO2)cccc1-c1ncn(C)n1 |
| InChI | InChI=1S/C21H22ClN7O2/c1-28-11-24-20(27-28)13-6-5-7-14(19(13)30-2)25-15-10-16(22)26-21-18(15)23-12-29(21)17-8-3-4-9-31-17/h5-7,10-12,17H,3-4,8-9H2,1-2H3,(H,25,26) |
| InChIKey | BMAQQAQWONEMSL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|