C20H22ClF2N5O3S — CID 134455571
N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylmethanesulfonamide (PubChem CID 134455571) has the molecular formula C20H22ClF2N5O3S and a molecular weight of 485.94 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 134455571 |
| Molecular Formula | C20H22ClF2N5O3S |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1ccccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2C1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C20H22ClF2N5O3S/c1-27(32(2,29)30)14-8-4-3-7-12(14)24-13-11-15(21)25-19-17(13)26-20(18(22)23)28(19)16-9-5-6-10-31-16/h3-4,7-8,11,16,18H,5-6,9-10H2,1-2H3,(H,24,25) |
| InChIKey | FUCGYDRATDUVQY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|