C23H29N5O4S — CID 134455944
cyclopropyl-[[2-methyl-7-[2-methylsulfonyl-4-(oxan-2-yl)anilino]-1H-imidazo[4,5-b]pyridin-5-yl]amino]methanol (PubChem CID 134455944) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is cyclopropyl-[[2-methyl-7-[2-methylsulfonyl-4-(oxan-2-yl)anilino]-1H-imidazo[4,5-b]pyridin-5-yl]amino]methanol.
| Compound Name | cyclopropyl-[[2-methyl-7-[2-methylsulfonyl-4-(oxan-2-yl)anilino]-1H-imidazo[4,5-b]pyridin-5-yl]amino]methanol |
|---|---|
| PubChem CID | 134455944 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | cyclopropyl-[[2-methyl-7-[2-methylsulfonyl-4-(oxan-2-yl)anilino]-1H-imidazo[4,5-b]pyridin-5-yl]amino]methanol |
| SMILES | Cc1nc2nc(NC(O)C3CC3)cc(Nc3ccc(C4CCCCO4)cc3S(C)(=O)=O)c2[nH]1 |
| InChI | InChI=1S/C23H29N5O4S/c1-13-24-21-17(12-20(27-22(21)25-13)28-23(29)14-6-7-14)26-16-9-8-15(11-19(16)33(2,30)31)18-5-3-4-10-32-18/h8-9,11-12,14,18,23,29H,3-7,10H2,1-2H3,(H3,24,25,26,27,28) |
| InChIKey | WJMDDYBMMZNHSK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|