C23H25ClF2N4O4S — CID 134456071
5-chloro-2-(difluoromethyl)-N-[2-methylsulfonyl-4-(oxolan-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine (PubChem CID 134456071) has the molecular formula C23H25ClF2N4O4S and a molecular weight of 526.99 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-N-[2-methylsulfonyl-4-(oxolan-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-2-(difluoromethyl)-N-[2-methylsulfonyl-4-(oxolan-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134456071 |
| Molecular Formula | C23H25ClF2N4O4S |
| Molecular Weight | 526.99 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-N-[2-methylsulfonyl-4-(oxolan-3-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
| SMILES | CS(=O)(=O)c1cc(C2CCOC2)ccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2C1CCCCO1 |
| InChI | InChI=1S/C23H25ClF2N4O4S/c1-35(31,32)17-10-13(14-7-9-33-12-14)5-6-15(17)27-16-11-18(24)28-22-20(16)29-23(21(25)26)30(22)19-4-2-3-8-34-19/h5-6,10-11,14,19,21H,2-4,7-9,12H2,1H3,(H,27,28) |
| InChIKey | APAGNQNBJKCXFJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.99 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|