About 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine
6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine (PubChem CID 134456134) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine.
Molecular Properties
| Compound Name | 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine |
| PubChem CID | 134456134 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine |
| SMILES | CC(C)c1cc2c(cn1)COC2 |
| InChI | InChI=1S/C10H13NO/c1-7(2)10-3-8-5-12-6-9(8)4-11-10/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | IYLCGJBTQWVNMB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine?
The IUPAC name of 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine (CID 134456134) is 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine.
What is the SMILES notation for 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine?
The canonical SMILES for 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine is CC(C)c1cc2c(cn1)COC2.
What is the InChIKey of 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine?
The InChIKey is IYLCGJBTQWVNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-7(2)10-3-8-5-12-6-9(8)4-11-10/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine?
6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine has a molecular weight of 163.22 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-1,3-dihydrofuro[3,4-c]pyridine is sourced from PubChem (CID 134456134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).