C22H22ClN5O2S — CID 134456291
5-chloro-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-2-methyl-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine (PubChem CID 134456291) has the molecular formula C22H22ClN5O2S and a molecular weight of 455.97 g/mol. Its IUPAC name is 5-chloro-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-2-methyl-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-2-methyl-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134456291 |
| Molecular Formula | C22H22ClN5O2S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-chloro-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-2-methyl-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
| SMILES | COc1c(Nc2cc(Cl)nc3c2nc(C)n3C2CCCCO2)cccc1-c1nccs1 |
| InChI | InChI=1S/C22H22ClN5O2S/c1-13-25-19-16(12-17(23)27-21(19)28(13)18-8-3-4-10-30-18)26-15-7-5-6-14(20(15)29-2)22-24-9-11-31-22/h5-7,9,11-12,18H,3-4,8,10H2,1-2H3,(H,26,27) |
| InChIKey | FGPNRRGRAAWWOY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|