C25H24F2N8O2S2 — CID 134456379
2-(difluoromethyl)-5-N-(5,6-dimethylpyrazin-2-yl)-7-N-[4-(2,5-dimethyl-1,3-thiazol-4-yl)-2-methylsulfonylphenyl]-1H-imidazo[4,5-b]pyridine-5,7-diamine (PubChem CID 134456379) has the molecular formula C25H24F2N8O2S2 and a molecular weight of 570.65 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-N-(5,6-dimethylpyrazin-2-yl)-7-N-[4-(2,5-dimethyl-1,3-thiazol-4-yl)-2-methylsulfonylphenyl]-1H-imidazo[4,5-b]pyridine-5,7-diamine.
| Compound Name | 2-(difluoromethyl)-5-N-(5,6-dimethylpyrazin-2-yl)-7-N-[4-(2,5-dimethyl-1,3-thiazol-4-yl)-2-methylsulfonylphenyl]-1H-imidazo[4,5-b]pyridine-5,7-diamine |
|---|---|
| PubChem CID | 134456379 |
| Molecular Formula | C25H24F2N8O2S2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 2-(difluoromethyl)-5-N-(5,6-dimethylpyrazin-2-yl)-7-N-[4-(2,5-dimethyl-1,3-thiazol-4-yl)-2-methylsulfonylphenyl]-1H-imidazo[4,5-b]pyridine-5,7-diamine |
| SMILES | Cc1nc(-c2ccc(Nc3cc(Nc4cnc(C)c(C)n4)nc4nc(C(F)F)[nH]c34)c(S(C)(=O)=O)c2)c(C)s1 |
| InChI | InChI=1S/C25H24F2N8O2S2/c1-11-12(2)29-20(10-28-11)32-19-9-17(22-24(33-19)35-25(34-22)23(26)27)31-16-7-6-15(8-18(16)39(5,36)37)21-13(3)38-14(4)30-21/h6-10,23H,1-5H3,(H3,29,31,32,33,34,35) |
| InChIKey | GUYQCAPGIAHHSI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |