C21H24ClF2N5O3S — CID 134456494
N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylethanesulfonamide (PubChem CID 134456494) has the molecular formula C21H24ClF2N5O3S and a molecular weight of 499.97 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylethanesulfonamide.
| Compound Name | N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 134456494 |
| Molecular Formula | C21H24ClF2N5O3S |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | N-[2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]phenyl]-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)c1ccccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2C1CCCCO1 |
| InChI | InChI=1S/C21H24ClF2N5O3S/c1-3-33(30,31)28(2)15-9-5-4-8-13(15)25-14-12-16(22)26-20-18(14)27-21(19(23)24)29(20)17-10-6-7-11-32-17/h4-5,8-9,12,17,19H,3,6-7,10-11H2,1-2H3,(H,25,26) |
| InChIKey | KNKUWSVSWMEZIL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|