C22H20ClF2N5O2S — CID 134456615
5-chloro-2-(difluoromethyl)-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine (PubChem CID 134456615) has the molecular formula C22H20ClF2N5O2S and a molecular weight of 491.95 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-2-(difluoromethyl)-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134456615 |
| Molecular Formula | C22H20ClF2N5O2S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-N-[2-methoxy-3-(1,3-thiazol-2-yl)phenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
| SMILES | COc1c(Nc2cc(Cl)nc3c2nc(C(F)F)n3C2CCCCO2)cccc1-c1nccs1 |
| InChI | InChI=1S/C22H20ClF2N5O2S/c1-31-18-12(22-26-8-10-33-22)5-4-6-13(18)27-14-11-15(23)28-20-17(14)29-21(19(24)25)30(20)16-7-2-3-9-32-16/h4-6,8,10-11,16,19H,2-3,7,9H2,1H3,(H,27,28) |
| InChIKey | IZLATGQSZQUBQY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|