C26H28ClF2N5O4S2 — CID 134456847
5-chloro-2-(difluoromethyl)-N-[4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfonylphenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine (PubChem CID 134456847) has the molecular formula C26H28ClF2N5O4S2 and a molecular weight of 612.12 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-N-[4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfonylphenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-2-(difluoromethyl)-N-[4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfonylphenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 134456847 |
| Molecular Formula | C26H28ClF2N5O4S2 |
| Molecular Weight | 612.12 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-N-[4-[5-(3-methoxypropyl)-1,3-thiazol-2-yl]-2-methylsulfonylphenyl]-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-amine |
| SMILES | COCCCc1cnc(-c2ccc(Nc3cc(Cl)nc4c3nc(C(F)F)n4C3CCCCO3)c(S(C)(=O)=O)c2)s1 |
| InChI | InChI=1S/C26H28ClF2N5O4S2/c1-37-10-5-6-16-14-30-26(39-16)15-8-9-17(19(12-15)40(2,35)36)31-18-13-20(27)32-24-22(18)33-25(23(28)29)34(24)21-7-3-4-11-38-21/h8-9,12-14,21,23H,3-7,10-11H2,1-2H3,(H,31,32) |
| InChIKey | CWZTWEPYEUTXPG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.12 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|