C22H18Cl4N4O4 — CID 134457612
N-[3,5-dichloro-2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 134457612) has the molecular formula C22H18Cl4N4O4 and a molecular weight of 544.22 g/mol. Its IUPAC name is N-[3,5-dichloro-2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3,5-dichloro-2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134457612 |
| Molecular Formula | C22H18Cl4N4O4 |
| Molecular Weight | 544.22 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | N-[3,5-dichloro-2-[[5-[(2,6-dichloro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Cl)cc(Cl)c1Nc1ncc(OCc2c(Cl)c(OC)cc(OC)c2Cl)cn1 |
| InChI | InChI=1S/C22H18Cl4N4O4/c1-4-18(31)29-15-6-11(23)5-14(24)21(15)30-22-27-8-12(9-28-22)34-10-13-19(25)16(32-2)7-17(33-3)20(13)26/h4-9H,1,10H2,2-3H3,(H,29,31)(H,27,28,30) |
| InChIKey | BPOCRPUQBGZHJD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.22 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|