About 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one
3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one (PubChem CID 134457886) has the molecular formula C18H9BrF6N2O2
and a molecular weight of 479.17 g/mol. Its IUPAC name is 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one |
| PubChem CID | 134457886 |
| Molecular Formula | C18H9BrF6N2O2 |
| Molecular Weight | 479.17 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one |
| SMILES | CC(=O)c1c(Nc2cc(F)c(F)cc2F)[nH]c2c(Br)ccc(C(F)(F)F)c2c1=O |
| InChI | InChI=1S/C18H9BrF6N2O2/c1-6(28)13-16(29)14-7(18(23,24)25)2-3-8(19)15(14)27-17(13)26-12-5-10(21)9(20)4-11(12)22/h2-5H,1H3,(H2,26,27,29) |
| InChIKey | PTUVSGOVLVMEOF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.17 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one?
The IUPAC name of 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one (CID 134457886) is 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one.
What is the SMILES notation for 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one?
The canonical SMILES for 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one is CC(=O)c1c(Nc2cc(F)c(F)cc2F)[nH]c2c(Br)ccc(C(F)(F)F)c2c1=O.
What is the InChIKey of 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one?
The InChIKey is PTUVSGOVLVMEOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9BrF6N2O2/c1-6(28)13-16(29)14-7(18(23,24)25)2-3-8(19)15(14)27-17(13)26-12-5-10(21)9(20)4-11(12)22/h2-5H,1H3,(H2,26,27,29).
What are the key properties of 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one?
3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one has a molecular weight of 479.17 g/mol, XLogP of 5.67, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-8-bromo-2-(2,4,5-trifluoroanilino)-5-(trifluoromethyl)-1H-quinolin-4-one is sourced from PubChem (CID 134457886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).