C24H22O6 — CID 134458176
7-ethoxy-2,5-dihydroxy-2-(4-phenylmethoxyphenyl)-3H-chromen-4-one (PubChem CID 134458176) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is 7-ethoxy-2,5-dihydroxy-2-(4-phenylmethoxyphenyl)-3H-chromen-4-one.
| Compound Name | 7-ethoxy-2,5-dihydroxy-2-(4-phenylmethoxyphenyl)-3H-chromen-4-one |
|---|---|
| PubChem CID | 134458176 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 7-ethoxy-2,5-dihydroxy-2-(4-phenylmethoxyphenyl)-3H-chromen-4-one |
| SMILES | CCOc1cc(O)c2c(c1)OC(O)(c1ccc(OCc3ccccc3)cc1)CC2=O |
| InChI | InChI=1S/C24H22O6/c1-2-28-19-12-20(25)23-21(26)14-24(27,30-22(23)13-19)17-8-10-18(11-9-17)29-15-16-6-4-3-5-7-16/h3-13,25,27H,2,14-15H2,1H3 |
| InChIKey | MJKULLNEPVPVDA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |