C4H13N3S2 — CID 134458223
N'-(2-aminoethyl)-N'-(disulfanyl)ethane-1,2-diamine (PubChem CID 134458223) has the molecular formula C4H13N3S2 and a molecular weight of 167.30 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-(disulfanyl)ethane-1,2-diamine.
| Compound Name | N'-(2-aminoethyl)-N'-(disulfanyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 134458223 |
| Molecular Formula | C4H13N3S2 |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | N'-(2-aminoethyl)-N'-(disulfanyl)ethane-1,2-diamine |
| SMILES | NCCN(CCN)SS |
| InChI | InChI=1S/C4H13N3S2/c5-1-3-7(9-8)4-2-6/h8H,1-6H2 |
| InChIKey | PPKQXSFYSWKZBO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|