About 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile
5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile (PubChem CID 13445840) has the molecular formula C15H13N3O
and a molecular weight of 251.29 g/mol. Its IUPAC name is 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile |
| PubChem CID | 13445840 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile |
| SMILES | N#Cc1c2c(cn(Cc3ccccc3)c1=O)CCN2 |
| InChI | InChI=1S/C15H13N3O/c16-8-13-14-12(6-7-17-14)10-18(15(13)19)9-11-4-2-1-3-5-11/h1-5,10,17H,6-7,9H2 |
| InChIKey | ZFRXMTDDFAZBKH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile?
The IUPAC name of 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile (CID 13445840) is 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile.
What is the SMILES notation for 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile?
The canonical SMILES for 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile is N#Cc1c2c(cn(Cc3ccccc3)c1=O)CCN2.
What is the InChIKey of 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile?
The InChIKey is ZFRXMTDDFAZBKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O/c16-8-13-14-12(6-7-17-14)10-18(15(13)19)9-11-4-2-1-3-5-11/h1-5,10,17H,6-7,9H2.
What are the key properties of 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile?
5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile has a molecular weight of 251.29 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-6-oxo-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-7-carbonitrile is sourced from PubChem (CID 13445840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).