C6H12N2O — CID 134458689
N-methyl-2-(methylamino)cyclopropane-1-carboxamide (PubChem CID 134458689) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is N-methyl-2-(methylamino)cyclopropane-1-carboxamide.
| Compound Name | N-methyl-2-(methylamino)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134458689 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | N-methyl-2-(methylamino)cyclopropane-1-carboxamide |
| SMILES | CNC(=O)C1CC1NC |
| InChI | InChI=1S/C6H12N2O/c1-7-5-3-4(5)6(9)8-2/h4-5,7H,3H2,1-2H3,(H,8,9) |
| InChIKey | RPUXZDZTRUXYKV-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |