C15H19N5O2 — CID 134458710
2-[[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]amino]-N-methylideneprop-2-enimidamide (PubChem CID 134458710) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]amino]-N-methylideneprop-2-enimidamide.
| Compound Name | 2-[[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]amino]-N-methylideneprop-2-enimidamide |
|---|---|
| PubChem CID | 134458710 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]amino]-N-methylideneprop-2-enimidamide |
| SMILES | [H]/N=C(\N=C)C(=C)N[C@H]1CCc2cn(C)c(=O)cc2N(C)C1=O |
| InChI | InChI=1S/C15H19N5O2/c1-9(14(16)17-2)18-11-6-5-10-8-19(3)13(21)7-12(10)20(4)15(11)22/h7-8,11,16,18H,1-2,5-6H2,3-4H3/b16-14-/t11-/m0/s1 |
| InChIKey | TWAIAKDFBPFVPO-NLPIWRNCSA-N |
| XLogP | 0.44 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|