C17H23F3N2O — CID 134458822
trans-(1S,5S)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine oxide (PubChem CID 134458822) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is trans-(1S,5S)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine oxide.
| Compound Name | trans-(1S,5S)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 134458822 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | trans-(1S,5S)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine oxide |
| SMILES | C/N=C/C1CC[C@H](c2cccc(C(F)(F)F)c2)C[C@@H]1[N+](C)(C)[O-] |
| InChI | InChI=1S/C17H23F3N2O/c1-21-11-14-8-7-13(10-16(14)22(2,3)23)12-5-4-6-15(9-12)17(18,19)20/h4-6,9,11,13-14,16H,7-8,10H2,1-3H3/b21-11+/t13-,14?,16-/m0/s1 |
| InChIKey | BEHQXLOUMVJOBL-FVYOCHISSA-N |
| XLogP | 4.23 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|